C17H14N2O6S — CID 4783634
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 4783634) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 4783634 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CN1C(=O)c2ccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)cc2C1=O |
| InChI | InChI=1S/C17H14N2O6S/c1-19-16(20)12-4-2-10(8-13(12)17(19)21)18-26(22,23)11-3-5-14-15(9-11)25-7-6-24-14/h2-5,8-9,18H,6-7H2,1H3 |
| InChIKey | IXSJVZVBOBXDJP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|