About N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide
N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide (PubChem CID 47839833) has the molecular formula C10H17N5O2
and a molecular weight of 239.28 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide |
| PubChem CID | 47839833 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide |
| SMILES | CCC(C)NC(=O)CNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H17N5O2/c1-3-8(2)14-9(16)4-12-10(17)5-15-7-11-6-13-15/h6-8H,3-5H2,1-2H3,(H,12,17)(H,14,16) |
| InChIKey | XXWFBMNWASKCKB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The IUPAC name of N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide (CID 47839833) is N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide.
What is the SMILES notation for N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The canonical SMILES for N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide is CCC(C)NC(=O)CNC(=O)Cn1cncn1.
What is the InChIKey of N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The InChIKey is XXWFBMNWASKCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O2/c1-3-8(2)14-9(16)4-12-10(17)5-15-7-11-6-13-15/h6-8H,3-5H2,1-2H3,(H,12,17)(H,14,16).
What are the key properties of N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide has a molecular weight of 239.28 g/mol, XLogP of -0.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide is sourced from PubChem (CID 47839833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).