C19H16F4N2O2 — CID 4784108
1-[4-(2-benzoyl-3,4,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone (PubChem CID 4784108) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-[4-(2-benzoyl-3,4,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2-benzoyl-3,4,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4784108 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-(2-benzoyl-3,4,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2c(F)c(F)c(F)c(F)c2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H16F4N2O2/c1-11(26)24-7-9-25(10-8-24)18-13(14(20)15(21)16(22)17(18)23)19(27)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3 |
| InChIKey | ODVDIOYDQNUDNJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|