C9H11F3N2O3S — CID 47842403
4,4,4-trifluoro-3-hydroxy-N-methoxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 47842403) has the molecular formula C9H11F3N2O3S and a molecular weight of 284.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-N-methoxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-N-methoxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 47842403 |
| Molecular Formula | C9H11F3N2O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-N-methoxy-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | CONC(=O)CC(O)(c1nc(C)cs1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O3S/c1-5-4-18-7(13-5)8(16,9(10,11)12)3-6(15)14-17-2/h4,16H,3H2,1-2H3,(H,14,15) |
| InChIKey | GGBIFOCZAJSIAJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|