C19H16N2O6S2 — CID 4784344
dimethyl 5-amino-3-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]thiophene-2,4-dicarboxylate (PubChem CID 4784344) has the molecular formula C19H16N2O6S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4784344 |
| Molecular Formula | C19H16N2O6S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | dimethyl 5-amino-3-[(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C19H16N2O6S2/c1-26-18(22)15-11(16(19(23)27-2)28-17(15)20)9-21-12-7-3-5-10-6-4-8-13(14(10)12)29(21,24)25/h3-8H,9,20H2,1-2H3 |
| InChIKey | BWLPKBVYXCCKNQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|