C15H12Br2N2O2 — CID 4784482
2,4-dibromo-6-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 4784482) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is 2,4-dibromo-6-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2,4-dibromo-6-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 4784482 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 2,4-dibromo-6-[3-(2-methylphenyl)-2,5-dihydro-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Cc1ccccc1C1=NC(c2cc(Br)cc(Br)c2O)ON1 |
| InChI | InChI=1S/C15H12Br2N2O2/c1-8-4-2-3-5-10(8)14-18-15(21-19-14)11-6-9(16)7-12(17)13(11)20/h2-7,15,20H,1H3,(H,18,19) |
| InChIKey | OORKAJARCFFTDB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|