C21H18F4N4O3 — CID 4784796
N-(2-morpholin-4-ylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide (PubChem CID 4784796) has the molecular formula C21H18F4N4O3 and a molecular weight of 450.39 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-(2-morpholin-4-ylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 4784796 |
| Molecular Formula | C21H18F4N4O3 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)C1=NN(c2c(F)c(F)cc(F)c2F)C(=O)CC1 |
| InChI | InChI=1S/C21H18F4N4O3/c22-12-11-13(23)19(25)20(18(12)24)29-17(30)6-5-15(27-29)21(31)26-14-3-1-2-4-16(14)28-7-9-32-10-8-28/h1-4,11H,5-10H2,(H,26,31) |
| InChIKey | LNZDSPQLHDSCMY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|