About N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide
N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 4784828) has the molecular formula C16H16Cl2N2O3
and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide |
| PubChem CID | 4784828 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-20(10-11-4-2-5-12(17)15(11)18)14(21)7-8-19-16(22)13-6-3-9-23-13/h2-6,9H,7-8,10H2,1H3,(H,19,22) |
| InChIKey | YMTZRVGFBKESCV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide?
The IUPAC name of N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide (CID 4784828) is N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide.
What is the SMILES notation for N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide?
The canonical SMILES for N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide is CN(Cc1cccc(Cl)c1Cl)C(=O)CCNC(=O)c1ccco1.
What is the InChIKey of N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide?
The InChIKey is YMTZRVGFBKESCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2O3/c1-20(10-11-4-2-5-12(17)15(11)18)14(21)7-8-19-16(22)13-6-3-9-23-13/h2-6,9H,7-8,10H2,1H3,(H,19,22).
What are the key properties of N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide?
N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide has a molecular weight of 355.22 g/mol, XLogP of 3.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,3-dichlorophenyl)methyl-methylamino]-3-oxopropyl]furan-2-carboxamide is sourced from PubChem (CID 4784828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).