C21H20N2O2 — CID 4785014
N-(3-acetylphenyl)-4-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 4785014) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-(3-acetylphenyl)-4-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 4785014 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-(3-acetylphenyl)-4-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(-n3c(C)ccc3C)cc2)c1 |
| InChI | InChI=1S/C21H20N2O2/c1-14-7-8-15(2)23(14)20-11-9-17(10-12-20)21(25)22-19-6-4-5-18(13-19)16(3)24/h4-13H,1-3H3,(H,22,25) |
| InChIKey | UNNDGEZMGUHVRC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|