C22H20F2N4O2 — CID 47850211
1-[3-fluoro-4-[4-[1-(3-fluorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 47850211) has the molecular formula C22H20F2N4O2 and a molecular weight of 410.42 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[1-(3-fluorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-[1-(3-fluorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 47850211 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[3-fluoro-4-[4-[1-(3-fluorophenyl)pyrazole-3-carbonyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3ccn(-c4cccc(F)c4)n3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H20F2N4O2/c1-15(29)16-5-6-21(19(24)13-16)26-9-11-27(12-10-26)22(30)20-7-8-28(25-20)18-4-2-3-17(23)14-18/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | QDIUQBNUGJKIKV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |