C24H27N3O4 — CID 4785037
1-cyclopentyl-3-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 4785037) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 4785037 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-cyclopentyl-3-[2-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1cc(C(=O)CN2C(=O)C(=O)N(C3CCCC3)C2=O)c(C)n1CCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4/c1-16-14-20(17(2)25(16)13-12-18-8-4-3-5-9-18)21(28)15-26-22(29)23(30)27(24(26)31)19-10-6-7-11-19/h3-5,8-9,14,19H,6-7,10-13,15H2,1-2H3 |
| InChIKey | MUDIBLORKOHCNC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|