C10H15N3O2 — CID 47850579
1-cyclopropyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]urea (PubChem CID 47850579) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 47850579 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-cyclopropyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]urea |
| SMILES | Cc1noc(C)c1CNC(=O)NC1CC1 |
| InChI | InChI=1S/C10H15N3O2/c1-6-9(7(2)15-13-6)5-11-10(14)12-8-3-4-8/h8H,3-5H2,1-2H3,(H2,11,12,14) |
| InChIKey | UCQDHJQUVSTANN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |