C20H20ClNO5 — CID 4785178
3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)prop-2-enamide (PubChem CID 4785178) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)prop-2-enamide.
| Compound Name | 3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4785178 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-(3-chloro-4,5-dimethoxyphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCC2COc3ccccc3O2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H20ClNO5/c1-24-18-10-13(9-15(21)20(18)25-2)7-8-19(23)22-11-14-12-26-16-5-3-4-6-17(16)27-14/h3-10,14H,11-12H2,1-2H3,(H,22,23) |
| InChIKey | MEUDVGSMHDNNBN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|