About N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide (PubChem CID 4785769) has the molecular formula C18H19N3O4
and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide |
| PubChem CID | 4785769 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4/c1-12-6-5-7-13(2)18(12)20-17(23)11-19-16(22)10-14-8-3-4-9-15(14)21(24)25/h3-9H,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | UBSKJHPTGDDTAP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide?
The IUPAC name of N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide (CID 4785769) is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide.
What is the SMILES notation for N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide?
The canonical SMILES for N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide is Cc1cccc(C)c1NC(=O)CNC(=O)Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide?
The InChIKey is UBSKJHPTGDDTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4/c1-12-6-5-7-13(2)18(12)20-17(23)11-19-16(22)10-14-8-3-4-9-15(14)21(24)25/h3-9H,10-11H2,1-2H3,(H,19,22)(H,20,23).
What are the key properties of N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide?
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide has a molecular weight of 341.37 g/mol, XLogP of 2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2-(2-nitrophenyl)acetamide is sourced from PubChem (CID 4785769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).