C22H34N2O2S — CID 4785965
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(3-methylbutyl)benzamide (PubChem CID 4785965) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(3-methylbutyl)benzamide.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 4785965 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanyl-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccccc1SCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H34N2O2S/c1-17(2)14-15-23-22(26)19-12-8-9-13-20(19)27-16-21(25)24-18-10-6-4-3-5-7-11-18/h8-9,12-13,17-18H,3-7,10-11,14-16H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | HWCYGJQNQRFSGV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |