C22H20N2O3 — CID 4786534
N-[(1,5-dimethylpyrrol-2-yl)methyl]-4-(2-oxo-2-phenylacetyl)benzamide (PubChem CID 4786534) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrrol-2-yl)methyl]-4-(2-oxo-2-phenylacetyl)benzamide.
| Compound Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-4-(2-oxo-2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 4786534 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-4-(2-oxo-2-phenylacetyl)benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(C(=O)C(=O)c3ccccc3)cc2)n1C |
| InChI | InChI=1S/C22H20N2O3/c1-15-8-13-19(24(15)2)14-23-22(27)18-11-9-17(10-12-18)21(26)20(25)16-6-4-3-5-7-16/h3-13H,14H2,1-2H3,(H,23,27) |
| InChIKey | JKPRWNBLTBBVLP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|