C21H29N3O3 — CID 4786865
2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-ethylhexyl)acetamide (PubChem CID 4786865) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-ethylhexyl)acetamide.
| Compound Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 4786865 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN1C(=O)NC2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-3-5-8-15(4-2)13-22-18(25)14-24-19(26)21(23-20(24)27)12-11-16-9-6-7-10-17(16)21/h6-7,9-10,15H,3-5,8,11-14H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | MBEITYRWTSYJEU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|