About [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate
[2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 4786926) has the molecular formula C17H16Cl2N2O3
and a molecular weight of 367.23 g/mol. Its IUPAC name is [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate |
| PubChem CID | 4786926 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | Cc1nc(NC(=O)COC(=O)CCc2ccccc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-11-13(18)9-14(19)17(20-11)21-15(22)10-24-16(23)8-7-12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3,(H,20,21,22) |
| InChIKey | HFGLAEQFSDFQIQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate?
The IUPAC name of [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate (CID 4786926) is [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate.
What is the SMILES notation for [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate?
The canonical SMILES for [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate is Cc1nc(NC(=O)COC(=O)CCc2ccccc2)c(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate?
The InChIKey is HFGLAEQFSDFQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N2O3/c1-11-13(18)9-14(19)17(20-11)21-15(22)10-24-16(23)8-7-12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3,(H,20,21,22).
What are the key properties of [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate?
[2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate has a molecular weight of 367.23 g/mol, XLogP of 3.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 3-phenylpropanoate is sourced from PubChem (CID 4786926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).