C16H11F3N4O2 — CID 4786972
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-indazole-3-carboxamide (PubChem CID 4786972) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 4786972 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1H-indazole-3-carboxamide |
| SMILES | O=C(CNC(=O)c1n[nH]c2ccccc12)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11F3N4O2/c17-9-5-6-11(14(19)13(9)18)21-12(24)7-20-16(25)15-8-3-1-2-4-10(8)22-23-15/h1-6H,7H2,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | VYXIIFPTMNDSRV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|