C15H18N4O2 — CID 4787464
N'-(cyclohexanecarbonyl)-1H-indazole-3-carbohydrazide (PubChem CID 4787464) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N'-(cyclohexanecarbonyl)-1H-indazole-3-carbohydrazide.
| Compound Name | N'-(cyclohexanecarbonyl)-1H-indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 4787464 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N'-(cyclohexanecarbonyl)-1H-indazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCC1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C15H18N4O2/c20-14(10-6-2-1-3-7-10)18-19-15(21)13-11-8-4-5-9-12(11)16-17-13/h4-5,8-10H,1-3,6-7H2,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | UWYTVJQOOHMMHJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|