C18H12N2O4S2 — CID 4788166
N-(5-methyl-1,3-thiazol-2-yl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 4788166) has the molecular formula C18H12N2O4S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 4788166 |
| Molecular Formula | C18H12N2O4S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)s1 |
| InChI | InChI=1S/C18H12N2O4S2/c1-10-9-19-18(25-10)20-17(22)11-6-7-13-15(8-11)26(23,24)14-5-3-2-4-12(14)16(13)21/h2-9H,1H3,(H,19,20,22) |
| InChIKey | GIGDVAPFEALZEE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |