About [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 4788324) has the molecular formula C22H21N3O5
and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 4788324 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)no1 |
| InChI | InChI=1S/C22H21N3O5/c1-14-12-19(25-30-14)22(28)29-13-20(26)24-18-11-7-6-10-17(18)21(27)23-15(2)16-8-4-3-5-9-16/h3-12,15H,13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | BAVJBVBCTKESGP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate?
The IUPAC name of [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate (CID 4788324) is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate is Cc1cc(C(=O)OCC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)no1.
What is the InChIKey of [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate?
The InChIKey is BAVJBVBCTKESGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O5/c1-14-12-19(25-30-14)22(28)29-13-20(26)24-18-11-7-6-10-17(18)21(27)23-15(2)16-8-4-3-5-9-16/h3-12,15H,13H2,1-2H3,(H,23,27)(H,24,26).
What are the key properties of [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate?
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate has a molecular weight of 407.43 g/mol, XLogP of 3.27, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 5-methyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 4788324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).