C17H24N2O2S — CID 4788330
N-(1-cyanocyclohexyl)-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 4788330) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-(1-cyanocyclohexyl)-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4788330 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC2(C#N)CCCCC2)c1C |
| InChI | InChI=1S/C17H24N2O2S/c1-12-10-13(2)15(4)16(14(12)3)22(20,21)19-17(11-18)8-6-5-7-9-17/h10,19H,5-9H2,1-4H3 |
| InChIKey | MXLSCJRGGOIPKR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |