About 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol
6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 4788422) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| PubChem CID | 4788422 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CN1CC=C(c3ccccc3)CC1)OCO2 |
| InChI | InChI=1S/C19H19NO3/c21-17-11-19-18(22-13-23-19)10-16(17)12-20-8-6-15(7-9-20)14-4-2-1-3-5-14/h1-6,10-11,21H,7-9,12-13H2 |
| InChIKey | DEHPUWVKKGZVQV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The IUPAC name of 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol (CID 4788422) is 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol is Oc1cc2c(cc1CN1CC=C(c3ccccc3)CC1)OCO2.
What is the InChIKey of 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The InChIKey is DEHPUWVKKGZVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c21-17-11-19-18(22-13-23-19)10-16(17)12-20-8-6-15(7-9-20)14-4-2-1-3-5-14/h1-6,10-11,21H,7-9,12-13H2.
What are the key properties of 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol?
6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol has a molecular weight of 309.37 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-benzodioxol-5-ol is sourced from PubChem (CID 4788422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).