About N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide
N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 4788899) has the molecular formula C20H21N3O2S2
and a molecular weight of 399.54 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 4788899 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCN(CC(=O)NCc1cccs1)C(=O)Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-2-23(13-18(24)21-12-17-9-6-10-26-17)19(25)11-16-14-27-20(22-16)15-7-4-3-5-8-15/h3-10,14H,2,11-13H2,1H3,(H,21,24) |
| InChIKey | HYLKPFAYMJKOIK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (CID 4788899) is N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide is CCN(CC(=O)NCc1cccs1)C(=O)Cc1csc(-c2ccccc2)n1.
What is the InChIKey of N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is HYLKPFAYMJKOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O2S2/c1-2-23(13-18(24)21-12-17-9-6-10-26-17)19(25)11-16-14-27-20(22-16)15-7-4-3-5-8-15/h3-10,14H,2,11-13H2,1H3,(H,21,24).
What are the key properties of N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide?
N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 399.54 g/mol, XLogP of 3.58, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 4788899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).