C13H19NO2 — CID 4789471
3-ethenoxy-N-[(4-methoxyphenyl)methyl]propan-1-amine (PubChem CID 4789471) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-ethenoxy-N-[(4-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-ethenoxy-N-[(4-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 4789471 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-ethenoxy-N-[(4-methoxyphenyl)methyl]propan-1-amine |
| SMILES | C=COCCCNCc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-3-16-10-4-9-14-11-12-5-7-13(15-2)8-6-12/h3,5-8,14H,1,4,9-11H2,2H3 |
| InChIKey | XPGAMMRRVUPYBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|