C23H19N5O5S — CID 4789523
2-(3-anilino-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 4789523) has the molecular formula C23H19N5O5S and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-(3-anilino-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-(3-anilino-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4789523 |
| Molecular Formula | C23H19N5O5S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-(3-anilino-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nc2ccccc2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C23H19N5O5S/c1-33-20-12-11-16(28(31)32)13-19(20)24-21(29)14-34-23-25-18-10-6-5-9-17(18)22(30)27(23)26-15-7-3-2-4-8-15/h2-13,26H,14H2,1H3,(H,24,29) |
| InChIKey | SCNYMURIZZBQSU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|