C24H29NO6 — CID 4789897
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 4789897) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 4789897 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)OCC(=O)NC2CCCc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H29NO6/c1-28-20-13-16(14-21(29-2)24(20)30-3)11-12-23(27)31-15-22(26)25-19-10-6-8-17-7-4-5-9-18(17)19/h4-5,7,9,13-14,19H,6,8,10-12,15H2,1-3H3,(H,25,26) |
| InChIKey | WMTBYKGOHYYIKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |