About ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate
ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate (PubChem CID 4790582) has the molecular formula C20H26N2O5S
and a molecular weight of 406.50 g/mol. Its IUPAC name is ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate |
| PubChem CID | 4790582 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C20H26N2O5S/c1-4-26-20(23)18-7-12-27-19(18)14-21-8-10-22(11-9-21)28(24,25)17-6-5-15(2)16(3)13-17/h5-7,12-13H,4,8-11,14H2,1-3H3 |
| InChIKey | SNKUJDNRWCYQTR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate?
The IUPAC name of ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate (CID 4790582) is ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate.
What is the SMILES notation for ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate?
The canonical SMILES for ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate is CCOC(=O)c1ccoc1CN1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1.
What is the InChIKey of ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate?
The InChIKey is SNKUJDNRWCYQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O5S/c1-4-26-20(23)18-7-12-27-19(18)14-21-8-10-22(11-9-21)28(24,25)17-6-5-15(2)16(3)13-17/h5-7,12-13H,4,8-11,14H2,1-3H3.
What are the key properties of ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate?
ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate has a molecular weight of 406.50 g/mol, XLogP of 2.58, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]furan-3-carboxylate is sourced from PubChem (CID 4790582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).