C16H21FN2O3 — CID 47906774
ethyl N-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]carbamate (PubChem CID 47906774) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is ethyl N-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 47906774 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethyl N-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]carbamate |
| SMILES | CCOC(=O)NC1CCN(C(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H21FN2O3/c1-2-22-16(21)18-14-6-8-19(9-7-14)15(20)11-12-4-3-5-13(17)10-12/h3-5,10,14H,2,6-9,11H2,1H3,(H,18,21) |
| InChIKey | BHEMKJQOJJVHJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |