C22H23ClN4O3 — CID 4791007
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-chlorobenzamide (PubChem CID 4791007) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-chlorobenzamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-chlorobenzamide |
|---|---|
| PubChem CID | 4791007 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-chlorobenzamide |
| SMILES | CCCCN(C(=O)c1cccc(Cl)c1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H23ClN4O3/c1-2-3-12-26(21(29)16-10-7-11-17(23)13-16)18-19(24)27(22(30)25-20(18)28)14-15-8-5-4-6-9-15/h4-11,13H,2-3,12,14,24H2,1H3,(H,25,28,30) |
| InChIKey | QXWNJXHMSZHDIU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |