C17H21FN4O3 — CID 4791039
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-fluorobenzamide (PubChem CID 4791039) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-fluorobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-fluorobenzamide |
|---|---|
| PubChem CID | 4791039 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-3-fluorobenzamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)c2cccc(F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H21FN4O3/c1-3-5-9-22-14(19)13(15(23)20-17(22)25)21(4-2)16(24)11-7-6-8-12(18)10-11/h6-8,10H,3-5,9,19H2,1-2H3,(H,20,23,25) |
| InChIKey | HXCBSFMULSOCMU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |