About 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide
3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide (PubChem CID 47917494) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide |
| PubChem CID | 47917494 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)N(C)c3cccc(C(C)C)c3)ccc2c1=O |
| InChI | InChI=1S/C21H23N3O3/c1-5-24-20(26)17-10-9-15(12-18(17)22-21(24)27)19(25)23(4)16-8-6-7-14(11-16)13(2)3/h6-13H,5H2,1-4H3,(H,22,27) |
| InChIKey | JEJSKBZEHOFVMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide?
The IUPAC name of 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide (CID 47917494) is 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide.
What is the SMILES notation for 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide?
The canonical SMILES for 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide is CCn1c(=O)[nH]c2cc(C(=O)N(C)c3cccc(C(C)C)c3)ccc2c1=O.
What is the InChIKey of 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide?
The InChIKey is JEJSKBZEHOFVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-5-24-20(26)17-10-9-15(12-18(17)22-21(24)27)19(25)23(4)16-8-6-7-14(11-16)13(2)3/h6-13H,5H2,1-4H3,(H,22,27).
What are the key properties of 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide?
3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide has a molecular weight of 365.43 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-methyl-2,4-dioxo-N-(3-propan-2-ylphenyl)-1H-quinazoline-7-carboxamide is sourced from PubChem (CID 47917494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).