About N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide
N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 4792629) has the molecular formula C19H20FN3O3S
and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide |
| PubChem CID | 4792629 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)NNC(=O)CSc2ccccc2F)c1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-12-7-13(2)9-14(8-12)19(26)21-10-17(24)22-23-18(25)11-27-16-6-4-3-5-15(16)20/h3-9H,10-11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | FZZHUQDCLWFWDV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide?
The IUPAC name of N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide (CID 4792629) is N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide.
What is the SMILES notation for N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide?
The canonical SMILES for N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)NCC(=O)NNC(=O)CSc2ccccc2F)c1.
What is the InChIKey of N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide?
The InChIKey is FZZHUQDCLWFWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O3S/c1-12-7-13(2)9-14(8-12)19(26)21-10-17(24)22-23-18(25)11-27-16-6-4-3-5-15(16)20/h3-9H,10-11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25).
What are the key properties of N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide?
N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide has a molecular weight of 389.45 g/mol, XLogP of 2.11, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-3,5-dimethylbenzamide is sourced from PubChem (CID 4792629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).