C15H13BrN2O2 — CID 4792773
5-bromo-N-[2-(1H-indol-3-yl)ethyl]furan-2-carboxamide (PubChem CID 4792773) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is 5-bromo-N-[2-(1H-indol-3-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(1H-indol-3-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4792773 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-bromo-N-[2-(1H-indol-3-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H13BrN2O2/c16-14-6-5-13(20-14)15(19)17-8-7-10-9-18-12-4-2-1-3-11(10)12/h1-6,9,18H,7-8H2,(H,17,19) |
| InChIKey | NRGKOUPUWPVWKJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |