C20H22F2N4O4 — CID 4792928
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2,4-difluorobenzoate (PubChem CID 4792928) has the molecular formula C20H22F2N4O4 and a molecular weight of 420.42 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2,4-difluorobenzoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 4792928 |
| Molecular Formula | C20H22F2N4O4 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2,4-difluorobenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccc(F)cc1F)n2CCC |
| InChI | InChI=1S/C20H22F2N4O4/c1-3-5-9-26-17-16(18(27)24-20(26)29)25(8-4-2)15(23-17)11-30-19(28)13-7-6-12(21)10-14(13)22/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,24,27,29) |
| InChIKey | TXFBITGEEFPHKF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |