C17H22ClN5O4S — CID 4793118
2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropylcarbamoyl)acetamide (PubChem CID 4793118) has the molecular formula C17H22ClN5O4S and a molecular weight of 427.91 g/mol. Its IUPAC name is 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropylcarbamoyl)acetamide.
| Compound Name | 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 4793118 |
| Molecular Formula | C17H22ClN5O4S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropylcarbamoyl)acetamide |
| SMILES | COCCCNC(=O)NC(=O)CSc1nnc(COc2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C17H22ClN5O4S/c1-23-14(10-27-13-6-4-12(18)5-7-13)21-22-17(23)28-11-15(24)20-16(25)19-8-3-9-26-2/h4-7H,3,8-11H2,1-2H3,(H2,19,20,24,25) |
| InChIKey | GXTCFNLOJWSYRU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|