C27H19ClN4O2S — CID 4793607
1-benzyl-6-chloro-4-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]quinoxaline-2,3-dione (PubChem CID 4793607) has the molecular formula C27H19ClN4O2S and a molecular weight of 499.00 g/mol. Its IUPAC name is 1-benzyl-6-chloro-4-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 1-benzyl-6-chloro-4-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 4793607 |
| Molecular Formula | C27H19ClN4O2S |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-benzyl-6-chloro-4-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]quinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(Cc2c(-c3ccccc3)nc3sccn23)c2cc(Cl)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H19ClN4O2S/c28-20-11-12-21-22(15-20)32(26(34)25(33)31(21)16-18-7-3-1-4-8-18)17-23-24(19-9-5-2-6-10-19)29-27-30(23)13-14-35-27/h1-15H,16-17H2 |
| InChIKey | KOTGTVUWHQPHRD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|