C11H20N2O2 — CID 47937805
N-(1-cyclopropylpyrrolidin-3-yl)-2-methoxypropanamide (PubChem CID 47937805) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)-2-methoxypropanamide.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 47937805 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)-2-methoxypropanamide |
| SMILES | COC(C)C(=O)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-8(15-2)11(14)12-9-5-6-13(7-9)10-3-4-10/h8-10H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | HXCIFOKYSJIVCK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |