C16H22N2O2S — CID 47937957
N-(1-cyclopropylpyrrolidin-3-yl)-2-(3-methoxyphenyl)sulfanylacetamide (PubChem CID 47937957) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)-2-(3-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)-2-(3-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 47937957 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)-2-(3-methoxyphenyl)sulfanylacetamide |
| SMILES | COc1cccc(SCC(=O)NC2CCN(C3CC3)C2)c1 |
| InChI | InChI=1S/C16H22N2O2S/c1-20-14-3-2-4-15(9-14)21-11-16(19)17-12-7-8-18(10-12)13-5-6-13/h2-4,9,12-13H,5-8,10-11H2,1H3,(H,17,19) |
| InChIKey | AOFTWKLOQJRCLV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |