About 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 4793924) has the molecular formula C17H20Cl2N4O4S
and a molecular weight of 447.34 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide.
Molecular Properties
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
| PubChem CID | 4793924 |
| Molecular Formula | C17H20Cl2N4O4S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)ccc1C |
| InChI | InChI=1S/C17H20Cl2N4O4S/c1-4-22(5-2)28(26,27)14-8-12(7-6-11(14)3)21-15(24)10-23-17(25)16(19)13(18)9-20-23/h6-9H,4-5,10H2,1-3H3,(H,21,24) |
| InChIKey | GTDVORMDEDMSEB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide?
The IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide (CID 4793924) is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide.
What is the SMILES notation for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide?
The canonical SMILES for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide is CCN(CC)S(=O)(=O)c1cc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)ccc1C.
What is the InChIKey of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide?
The InChIKey is GTDVORMDEDMSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20Cl2N4O4S/c1-4-22(5-2)28(26,27)14-8-12(7-6-11(14)3)21-15(24)10-23-17(25)16(19)13(18)9-20-23/h6-9H,4-5,10H2,1-3H3,(H,21,24).
What are the key properties of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide?
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide has a molecular weight of 447.34 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide is sourced from PubChem (CID 4793924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).