C17H15N3O5 — CID 4794455
8-(3-methoxyphenyl)-11-methyl-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione (PubChem CID 4794455) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is 8-(3-methoxyphenyl)-11-methyl-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione.
| Compound Name | 8-(3-methoxyphenyl)-11-methyl-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
|---|---|
| PubChem CID | 4794455 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 8-(3-methoxyphenyl)-11-methyl-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| SMILES | COc1cccc(C2C3=C(COC3=O)Nc3[nH]c(=O)n(C)c(=O)c32)c1 |
| InChI | InChI=1S/C17H15N3O5/c1-20-15(21)13-11(8-4-3-5-9(6-8)24-2)12-10(7-25-16(12)22)18-14(13)19-17(20)23/h3-6,11,18H,7H2,1-2H3,(H,19,23) |
| InChIKey | WQUUQUFGINWLSR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |