About methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate
methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (PubChem CID 47946190) has the molecular formula C17H16FNO4S
and a molecular weight of 349.38 g/mol. Its IUPAC name is methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| PubChem CID | 47946190 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(F)c(S(=O)(=O)N2c3ccccc3CC2C)c1 |
| InChI | InChI=1S/C17H16FNO4S/c1-11-9-12-5-3-4-6-15(12)19(11)24(21,22)16-10-13(17(20)23-2)7-8-14(16)18/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | TYWCXJSYVAOKRG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The IUPAC name of methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (CID 47946190) is methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
What is the SMILES notation for methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The canonical SMILES for methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate is COC(=O)c1ccc(F)c(S(=O)(=O)N2c3ccccc3CC2C)c1.
What is the InChIKey of methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The InChIKey is TYWCXJSYVAOKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO4S/c1-11-9-12-5-3-4-6-15(12)19(11)24(21,22)16-10-13(17(20)23-2)7-8-14(16)18/h3-8,10-11H,9H2,1-2H3.
What are the key properties of methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate has a molecular weight of 349.38 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-fluoro-3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate is sourced from PubChem (CID 47946190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).