C19H20N2O5S — CID 47946892
methyl 3-[[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylamino]benzoate (PubChem CID 47946892) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is methyl 3-[[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylamino]benzoate.
| Compound Name | methyl 3-[[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 47946892 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | methyl 3-[[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1cccc(NS(=O)(=O)c2cccc(C(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-26-19(23)15-7-4-8-16(12-15)20-27(24,25)17-9-5-6-14(13-17)18(22)21-10-2-3-11-21/h4-9,12-13,20H,2-3,10-11H2,1H3 |
| InChIKey | YSFIMMPBWJVLJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |