C27H27N3O4 — CID 4795580
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylacetamide (PubChem CID 4795580) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 4795580 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylacetamide |
| SMILES | CCOc1ccc(CN(C)C(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-3-34-23-16-14-20(15-17-23)18-29(2)24(31)19-30-25(32)27(28-26(30)33,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-17H,3,18-19H2,1-2H3,(H,28,33) |
| InChIKey | POTLGGBPNYKYBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|