C21H31N3O5S — CID 4795705
tert-butyl 2-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 4795705) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 4795705 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | tert-butyl 2-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCN3C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H31N3O5S/c1-16-7-9-17(10-8-16)30(27,28)23-14-12-22(13-15-23)19(25)18-6-5-11-24(18)20(26)29-21(2,3)4/h7-10,18H,5-6,11-15H2,1-4H3 |
| InChIKey | ILFSFBHKGAUPHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |