About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 47959042) has the molecular formula C9H12N4O3S
and a molecular weight of 256.29 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide |
| PubChem CID | 47959042 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1CNS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H12N4O3S/c1-6-9(7(2)16-13-6)5-12-17(14,15)8-3-10-11-4-8/h3-4,12H,5H2,1-2H3,(H,10,11) |
| InChIKey | SMBISHCLOHGVTC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide (CID 47959042) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide is Cc1noc(C)c1CNS(=O)(=O)c1cn[nH]c1.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide?
The InChIKey is SMBISHCLOHGVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3S/c1-6-9(7(2)16-13-6)5-12-17(14,15)8-3-10-11-4-8/h3-4,12H,5H2,1-2H3,(H,10,11).
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide has a molecular weight of 256.29 g/mol, XLogP of 0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 47959042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).