About 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide
4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 47959380) has the molecular formula C14H14ClF3N2O2S2
and a molecular weight of 398.86 g/mol. Its IUPAC name is 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 47959380 |
| Molecular Formula | C14H14ClF3N2O2S2 |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCc1nc(CN(C)S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C14H14ClF3N2O2S2/c1-3-13-19-9(8-23-13)7-20(2)24(21,22)10-4-5-12(15)11(6-10)14(16,17)18/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | AJCVQHLFUPOHNQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide (CID 47959380) is 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide is CCc1nc(CN(C)S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cs1.
What is the InChIKey of 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide?
The InChIKey is AJCVQHLFUPOHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF3N2O2S2/c1-3-13-19-9(8-23-13)7-20(2)24(21,22)10-4-5-12(15)11(6-10)14(16,17)18/h4-6,8H,3,7H2,1-2H3.
What are the key properties of 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide?
4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide has a molecular weight of 398.86 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 47959380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).