C12H9ClFN3O2 — CID 4796470
N-(3-chloro-4-fluorophenyl)-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 4796470) has the molecular formula C12H9ClFN3O2 and a molecular weight of 281.67 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 4796470 |
| Molecular Formula | C12H9ClFN3O2 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(F)c(Cl)c2)ccc1=O |
| InChI | InChI=1S/C12H9ClFN3O2/c1-17-11(18)5-4-10(16-17)12(19)15-7-2-3-9(14)8(13)6-7/h2-6H,1H3,(H,15,19) |
| InChIKey | PJQGZUSONZDKLV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |