About (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate
(4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate (PubChem CID 4797619) has the molecular formula C22H17N5O3
and a molecular weight of 399.41 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate |
| PubChem CID | 4797619 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate |
| SMILES | Cn1ccnc1-c1nc2ccccc2n(CC(=O)OCc2ccc(C#N)cc2)c1=O |
| InChI | InChI=1S/C22H17N5O3/c1-26-11-10-24-21(26)20-22(29)27(18-5-3-2-4-17(18)25-20)13-19(28)30-14-16-8-6-15(12-23)7-9-16/h2-11H,13-14H2,1H3 |
| InChIKey | YGVNOSDXDFJFJR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate?
The IUPAC name of (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate (CID 4797619) is (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate?
The canonical SMILES for (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate is Cn1ccnc1-c1nc2ccccc2n(CC(=O)OCc2ccc(C#N)cc2)c1=O.
What is the InChIKey of (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate?
The InChIKey is YGVNOSDXDFJFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N5O3/c1-26-11-10-24-21(26)20-22(29)27(18-5-3-2-4-17(18)25-20)13-19(28)30-14-16-8-6-15(12-23)7-9-16/h2-11H,13-14H2,1H3.
What are the key properties of (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate?
(4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate has a molecular weight of 399.41 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-[3-(1-methylimidazol-2-yl)-2-oxoquinoxalin-1-yl]acetate is sourced from PubChem (CID 4797619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).